C12H16F3N5 — CID 115489641
5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridine-2-carboximidamide (PubChem CID 115489641) has the molecular formula C12H16F3N5 and a molecular weight of 287.29 g/mol. Its IUPAC name is 5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridine-2-carboximidamide.
| Compound Name | 5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 115489641 |
| Molecular Formula | C12H16F3N5 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(CC(F)(F)F)CC2)cn1 |
| InChI | InChI=1S/C12H16F3N5/c13-12(14,15)8-19-3-5-20(6-4-19)9-1-2-10(11(16)17)18-7-9/h1-2,7H,3-6,8H2,(H3,16,17) |
| InChIKey | WHAGYQXCTBIKSP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|