C14H15F3N2O2 — CID 115491599
2-(2-cyanophenoxy)-N-(5,5,5-trifluoropentyl)acetamide (PubChem CID 115491599) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-(5,5,5-trifluoropentyl)acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-(5,5,5-trifluoropentyl)acetamide |
|---|---|
| PubChem CID | 115491599 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-(5,5,5-trifluoropentyl)acetamide |
| SMILES | N#Cc1ccccc1OCC(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O2/c15-14(16,17)7-3-4-8-19-13(20)10-21-12-6-2-1-5-11(12)9-18/h1-2,5-6H,3-4,7-8,10H2,(H,19,20) |
| InChIKey | YIAYDYYLQLFNHL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|