C12H7F3N6 — CID 115503366
4-imidazol-1-yl-6-(2,4,5-trifluorophenyl)-1,3,5-triazin-2-amine (PubChem CID 115503366) has the molecular formula C12H7F3N6 and a molecular weight of 292.22 g/mol. Its IUPAC name is 4-imidazol-1-yl-6-(2,4,5-trifluorophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-imidazol-1-yl-6-(2,4,5-trifluorophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 115503366 |
| Molecular Formula | C12H7F3N6 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-imidazol-1-yl-6-(2,4,5-trifluorophenyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(-c2cc(F)c(F)cc2F)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C12H7F3N6/c13-7-4-9(15)8(14)3-6(7)10-18-11(16)20-12(19-10)21-2-1-17-5-21/h1-5H,(H2,16,18,19,20) |
| InChIKey | VPODDSCBDQBJGW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|