C13H13N3O3 — CID 11550649
1,3-dioxo-N-phenyl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide (PubChem CID 11550649) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 1,3-dioxo-N-phenyl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide.
| Compound Name | 1,3-dioxo-N-phenyl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide |
|---|---|
| PubChem CID | 11550649 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1,3-dioxo-N-phenyl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide |
| SMILES | O=C1NC(=O)C2(C(=O)Nc3ccccc3)CCCN12 |
| InChI | InChI=1S/C13H13N3O3/c17-10(14-9-5-2-1-3-6-9)13-7-4-8-16(13)12(19)15-11(13)18/h1-3,5-6H,4,7-8H2,(H,14,17)(H,15,18,19) |
| InChIKey | SFMLHBLSVFLIKZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|