C12H16F2N2 — CID 115506691
3,5-difluoro-1-N-(1-methylcyclopentyl)benzene-1,2-diamine (PubChem CID 115506691) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 3,5-difluoro-1-N-(1-methylcyclopentyl)benzene-1,2-diamine.
| Compound Name | 3,5-difluoro-1-N-(1-methylcyclopentyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115506691 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 3,5-difluoro-1-N-(1-methylcyclopentyl)benzene-1,2-diamine |
| SMILES | CC1(Nc2cc(F)cc(F)c2N)CCCC1 |
| InChI | InChI=1S/C12H16F2N2/c1-12(4-2-3-5-12)16-10-7-8(13)6-9(14)11(10)15/h6-7,16H,2-5,15H2,1H3 |
| InChIKey | QAOUUMHWAQPTFF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|