C14H16F2N2S — CID 115508313
5,7-difluoro-3-(1-methylcyclohexyl)-1H-benzimidazole-2-thione (PubChem CID 115508313) has the molecular formula C14H16F2N2S and a molecular weight of 282.36 g/mol. Its IUPAC name is 5,7-difluoro-3-(1-methylcyclohexyl)-1H-benzimidazole-2-thione.
| Compound Name | 5,7-difluoro-3-(1-methylcyclohexyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115508313 |
| Molecular Formula | C14H16F2N2S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 5,7-difluoro-3-(1-methylcyclohexyl)-1H-benzimidazole-2-thione |
| SMILES | CC1(n2c(=S)[nH]c3c(F)cc(F)cc32)CCCCC1 |
| InChI | InChI=1S/C14H16F2N2S/c1-14(5-3-2-4-6-14)18-11-8-9(15)7-10(16)12(11)17-13(18)19/h7-8H,2-6H2,1H3,(H,17,19) |
| InChIKey | COFSWNVNGCPFRJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|