C8H6ClF2NO6S2 — CID 115509884
2-(3,5-difluoro-2-nitrophenyl)sulfonylethanesulfonyl chloride (PubChem CID 115509884) has the molecular formula C8H6ClF2NO6S2 and a molecular weight of 349.72 g/mol. Its IUPAC name is 2-(3,5-difluoro-2-nitrophenyl)sulfonylethanesulfonyl chloride.
| Compound Name | 2-(3,5-difluoro-2-nitrophenyl)sulfonylethanesulfonyl chloride |
|---|---|
| PubChem CID | 115509884 |
| Molecular Formula | C8H6ClF2NO6S2 |
| Molecular Weight | 349.72 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | 2-(3,5-difluoro-2-nitrophenyl)sulfonylethanesulfonyl chloride |
| SMILES | O=[N+]([O-])c1c(F)cc(F)cc1S(=O)(=O)CCS(=O)(=O)Cl |
| InChI | InChI=1S/C8H6ClF2NO6S2/c9-20(17,18)2-1-19(15,16)7-4-5(10)3-6(11)8(7)12(13)14/h3-4H,1-2H2 |
| InChIKey | SZAZWCOJUCCPFX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 111.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.72 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|