C9H14F3NO2 — CID 115514640
2-cyclopropyl-2-(4,4,4-trifluorobutylamino)acetic acid (PubChem CID 115514640) has the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. Its IUPAC name is 2-cyclopropyl-2-(4,4,4-trifluorobutylamino)acetic acid.
| Compound Name | 2-cyclopropyl-2-(4,4,4-trifluorobutylamino)acetic acid |
|---|---|
| PubChem CID | 115514640 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-cyclopropyl-2-(4,4,4-trifluorobutylamino)acetic acid |
| SMILES | O=C(O)C(NCCCC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C9H14F3NO2/c10-9(11,12)4-1-5-13-7(8(14)15)6-2-3-6/h6-7,13H,1-5H2,(H,14,15) |
| InChIKey | VNUOGHDBSVVUMP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|