C11H20F3NO — CID 115515964
1-(diethylamino)-7,7,7-trifluoroheptan-3-one (PubChem CID 115515964) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 1-(diethylamino)-7,7,7-trifluoroheptan-3-one.
| Compound Name | 1-(diethylamino)-7,7,7-trifluoroheptan-3-one |
|---|---|
| PubChem CID | 115515964 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-(diethylamino)-7,7,7-trifluoroheptan-3-one |
| SMILES | CCN(CC)CCC(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c1-3-15(4-2)9-7-10(16)6-5-8-11(12,13)14/h3-9H2,1-2H3 |
| InChIKey | YMRNFSAYKXZJIP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |