C15H23F3N2 — CID 115516808
5,5,5-trifluoro-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]pentan-1-amine (PubChem CID 115516808) has the molecular formula C15H23F3N2 and a molecular weight of 288.36 g/mol. Its IUPAC name is 5,5,5-trifluoro-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]pentan-1-amine.
| Compound Name | 5,5,5-trifluoro-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 115516808 |
| Molecular Formula | C15H23F3N2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 5,5,5-trifluoro-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]pentan-1-amine |
| SMILES | Cc1cc(C)c(C(C)NCCCCC(F)(F)F)c(C)n1 |
| InChI | InChI=1S/C15H23F3N2/c1-10-9-11(2)20-13(4)14(10)12(3)19-8-6-5-7-15(16,17)18/h9,12,19H,5-8H2,1-4H3 |
| InChIKey | URZQWDPLHUHNHA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|