C12H18F3N3O — CID 136952773
2,4-dimethyl-5-[1-(4,4,4-trifluorobutylamino)ethyl]-1H-pyrimidin-6-one (PubChem CID 136952773) has the molecular formula C12H18F3N3O and a molecular weight of 277.29 g/mol. Its IUPAC name is 2,4-dimethyl-5-[1-(4,4,4-trifluorobutylamino)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 2,4-dimethyl-5-[1-(4,4,4-trifluorobutylamino)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136952773 |
| Molecular Formula | C12H18F3N3O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2,4-dimethyl-5-[1-(4,4,4-trifluorobutylamino)ethyl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C)c(C(C)NCCCC(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C12H18F3N3O/c1-7(16-6-4-5-12(13,14)15)10-8(2)17-9(3)18-11(10)19/h7,16H,4-6H2,1-3H3,(H,17,18,19) |
| InChIKey | YKEXIWFJDRLGEW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|