C7H7BrF3N3O2 — CID 115517847
4-bromo-3-nitro-1-(4,4,4-trifluorobutyl)pyrazole (PubChem CID 115517847) has the molecular formula C7H7BrF3N3O2 and a molecular weight of 302.05 g/mol. Its IUPAC name is 4-bromo-3-nitro-1-(4,4,4-trifluorobutyl)pyrazole.
| Compound Name | 4-bromo-3-nitro-1-(4,4,4-trifluorobutyl)pyrazole |
|---|---|
| PubChem CID | 115517847 |
| Molecular Formula | C7H7BrF3N3O2 |
| Molecular Weight | 302.05 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 4-bromo-3-nitro-1-(4,4,4-trifluorobutyl)pyrazole |
| SMILES | O=[N+]([O-])c1nn(CCCC(F)(F)F)cc1Br |
| InChI | InChI=1S/C7H7BrF3N3O2/c8-5-4-13(12-6(5)14(15)16)3-1-2-7(9,10)11/h4H,1-3H2 |
| InChIKey | XVUXPHWMBMFOMF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.05 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|