C7H11BrN4O2 — CID 61177778
2-(4-bromo-3-nitropyrazol-1-yl)-N,N-dimethylethanamine (PubChem CID 61177778) has the molecular formula C7H11BrN4O2 and a molecular weight of 263.09 g/mol. Its IUPAC name is 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 61177778 |
| Molecular Formula | C7H11BrN4O2 |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1cc(Br)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C7H11BrN4O2/c1-10(2)3-4-11-5-6(8)7(9-11)12(13)14/h5H,3-4H2,1-2H3 |
| InChIKey | LMRHJRRWAMQYRQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|