C13H13F3INO — CID 115519748
7-iodo-2-(4,4,4-trifluorobutyl)-3,4-dihydroisoquinolin-1-one (PubChem CID 115519748) has the molecular formula C13H13F3INO and a molecular weight of 383.15 g/mol. Its IUPAC name is 7-iodo-2-(4,4,4-trifluorobutyl)-3,4-dihydroisoquinolin-1-one.
| Compound Name | 7-iodo-2-(4,4,4-trifluorobutyl)-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 115519748 |
| Molecular Formula | C13H13F3INO |
| Molecular Weight | 383.15 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 7-iodo-2-(4,4,4-trifluorobutyl)-3,4-dihydroisoquinolin-1-one |
| SMILES | O=C1c2cc(I)ccc2CCN1CCCC(F)(F)F |
| InChI | InChI=1S/C13H13F3INO/c14-13(15,16)5-1-6-18-7-4-9-2-3-10(17)8-11(9)12(18)19/h2-3,8H,1,4-7H2 |
| InChIKey | UWZWYGKPRSTOST-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.15 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|