C9H14F3N3O2S2 — CID 115520750
2-amino-4-methyl-N-(5,5,5-trifluoropentyl)-1,3-thiazole-5-sulfonamide (PubChem CID 115520750) has the molecular formula C9H14F3N3O2S2 and a molecular weight of 317.36 g/mol. Its IUPAC name is 2-amino-4-methyl-N-(5,5,5-trifluoropentyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-amino-4-methyl-N-(5,5,5-trifluoropentyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 115520750 |
| Molecular Formula | C9H14F3N3O2S2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-amino-4-methyl-N-(5,5,5-trifluoropentyl)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(N)sc1S(=O)(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C9H14F3N3O2S2/c1-6-7(18-8(13)15-6)19(16,17)14-5-3-2-4-9(10,11)12/h14H,2-5H2,1H3,(H2,13,15) |
| InChIKey | RZSLHBAKYAYMKR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|