C23H34N2O — CID 11552128
13-(4-phenylpiperazin-1-yl)tridec-11-yn-2-one (PubChem CID 11552128) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is 13-(4-phenylpiperazin-1-yl)tridec-11-yn-2-one.
| Compound Name | 13-(4-phenylpiperazin-1-yl)tridec-11-yn-2-one |
|---|---|
| PubChem CID | 11552128 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | 13-(4-phenylpiperazin-1-yl)tridec-11-yn-2-one |
| SMILES | CC(=O)CCCCCCCCC#CCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H34N2O/c1-22(26)14-10-7-5-3-2-4-6-8-13-17-24-18-20-25(21-19-24)23-15-11-9-12-16-23/h9,11-12,15-16H,2-7,10,14,17-21H2,1H3 |
| InChIKey | OEYJKIDFWKTEQX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|