C26H29N3O2 — CID 11654574
3,4-dimethyl-1-[4-[4-(4-phenylphenyl)piperazin-1-yl]but-2-ynyl]pyrrolidine-2,5-dione (PubChem CID 11654574) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3,4-dimethyl-1-[4-[4-(4-phenylphenyl)piperazin-1-yl]but-2-ynyl]pyrrolidine-2,5-dione.
| Compound Name | 3,4-dimethyl-1-[4-[4-(4-phenylphenyl)piperazin-1-yl]but-2-ynyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11654574 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3,4-dimethyl-1-[4-[4-(4-phenylphenyl)piperazin-1-yl]but-2-ynyl]pyrrolidine-2,5-dione |
| SMILES | CC1C(=O)N(CC#CCN2CCN(c3ccc(-c4ccccc4)cc3)CC2)C(=O)C1C |
| InChI | InChI=1S/C26H29N3O2/c1-20-21(2)26(31)29(25(20)30)15-7-6-14-27-16-18-28(19-17-27)24-12-10-23(11-13-24)22-8-4-3-5-9-22/h3-5,8-13,20-21H,14-19H2,1-2H3 |
| InChIKey | FBMAEDDPACTXKG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|