C11H17F3N2S — CID 115521524
4-tert-butyl-3-(4,4,4-trifluorobutyl)-1H-imidazole-2-thione (PubChem CID 115521524) has the molecular formula C11H17F3N2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 4-tert-butyl-3-(4,4,4-trifluorobutyl)-1H-imidazole-2-thione.
| Compound Name | 4-tert-butyl-3-(4,4,4-trifluorobutyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 115521524 |
| Molecular Formula | C11H17F3N2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-tert-butyl-3-(4,4,4-trifluorobutyl)-1H-imidazole-2-thione |
| SMILES | CC(C)(C)c1c[nH]c(=S)n1CCCC(F)(F)F |
| InChI | InChI=1S/C11H17F3N2S/c1-10(2,3)8-7-15-9(17)16(8)6-4-5-11(12,13)14/h7H,4-6H2,1-3H3,(H,15,17) |
| InChIKey | YKNSNHRCEKEKEX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|