C9H13F3N2S — CID 115521528
4-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione (PubChem CID 115521528) has the molecular formula C9H13F3N2S and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione.
| Compound Name | 4-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 115521528 |
| Molecular Formula | C9H13F3N2S |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione |
| SMILES | Cc1c[nH]c(=S)n1CCCCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2S/c1-7-6-13-8(15)14(7)5-3-2-4-9(10,11)12/h6H,2-5H2,1H3,(H,13,15) |
| InChIKey | LFRWJDKOHLTEAW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|