C10H14F3NO3 — CID 115521710
1-(5,5,5-trifluoropentylcarbamoyl)cyclopropane-1-carboxylic acid (PubChem CID 115521710) has the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. Its IUPAC name is 1-(5,5,5-trifluoropentylcarbamoyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(5,5,5-trifluoropentylcarbamoyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 115521710 |
| Molecular Formula | C10H14F3NO3 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-(5,5,5-trifluoropentylcarbamoyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)NCCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H14F3NO3/c11-10(12,13)3-1-2-6-14-7(15)9(4-5-9)8(16)17/h1-6H2,(H,14,15)(H,16,17) |
| InChIKey | YMPWUISRPNKIDI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|