C14H23F3N2O2 — CID 115522542
3-tert-butyl-1-(5,5,5-trifluoropentyl)-1,4-diazepane-2,5-dione (PubChem CID 115522542) has the molecular formula C14H23F3N2O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 3-tert-butyl-1-(5,5,5-trifluoropentyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-tert-butyl-1-(5,5,5-trifluoropentyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 115522542 |
| Molecular Formula | C14H23F3N2O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-tert-butyl-1-(5,5,5-trifluoropentyl)-1,4-diazepane-2,5-dione |
| SMILES | CC(C)(C)C1NC(=O)CCN(CCCCC(F)(F)F)C1=O |
| InChI | InChI=1S/C14H23F3N2O2/c1-13(2,3)11-12(21)19(9-6-10(20)18-11)8-5-4-7-14(15,16)17/h11H,4-9H2,1-3H3,(H,18,20) |
| InChIKey | GFRMXJDSEIDPGJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|