C9H10F3N3S — CID 115522986
3-methyl-5-(4,4,4-trifluorobutylamino)-1,2-thiazole-4-carbonitrile (PubChem CID 115522986) has the molecular formula C9H10F3N3S and a molecular weight of 249.26 g/mol. Its IUPAC name is 3-methyl-5-(4,4,4-trifluorobutylamino)-1,2-thiazole-4-carbonitrile.
| Compound Name | 3-methyl-5-(4,4,4-trifluorobutylamino)-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 115522986 |
| Molecular Formula | C9H10F3N3S |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 3-methyl-5-(4,4,4-trifluorobutylamino)-1,2-thiazole-4-carbonitrile |
| SMILES | Cc1nsc(NCCCC(F)(F)F)c1C#N |
| InChI | InChI=1S/C9H10F3N3S/c1-6-7(5-13)8(16-15-6)14-4-2-3-9(10,11)12/h14H,2-4H2,1H3 |
| InChIKey | DTALDPINZWINOK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|