C6H5N3OS — CID 138481254
N-(4-cyano-3-methyl-1,2-thiazol-5-yl)formamide (PubChem CID 138481254) has the molecular formula C6H5N3OS and a molecular weight of 167.19 g/mol. Its IUPAC name is N-(4-cyano-3-methyl-1,2-thiazol-5-yl)formamide.
| Compound Name | N-(4-cyano-3-methyl-1,2-thiazol-5-yl)formamide |
|---|---|
| PubChem CID | 138481254 |
| Molecular Formula | C6H5N3OS |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | N-(4-cyano-3-methyl-1,2-thiazol-5-yl)formamide |
| SMILES | Cc1nsc(NC=O)c1C#N |
| InChI | InChI=1S/C6H5N3OS/c1-4-5(2-7)6(8-3-10)11-9-4/h3H,1H3,(H,8,10) |
| InChIKey | OCTMZDNMEVPXIA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|