C6H9N3OS — CID 82503250
N-[4-(aminomethyl)-3-methyl-1,2-thiazol-5-yl]formamide (PubChem CID 82503250) has the molecular formula C6H9N3OS and a molecular weight of 171.22 g/mol. Its IUPAC name is N-[4-(aminomethyl)-3-methyl-1,2-thiazol-5-yl]formamide.
| Compound Name | N-[4-(aminomethyl)-3-methyl-1,2-thiazol-5-yl]formamide |
|---|---|
| PubChem CID | 82503250 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | N-[4-(aminomethyl)-3-methyl-1,2-thiazol-5-yl]formamide |
| SMILES | Cc1nsc(NC=O)c1CN |
| InChI | InChI=1S/C6H9N3OS/c1-4-5(2-7)6(8-3-10)11-9-4/h3H,2,7H2,1H3,(H,8,10) |
| InChIKey | VJAODQRMTVQVCI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|