About N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane
N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane (PubChem CID 142027710) has the molecular formula C8H14N2OS
and a molecular weight of 186.28 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane.
Molecular Properties
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane |
| PubChem CID | 142027710 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane |
| SMILES | CC.Cc1nc(NC=O)sc1C |
| InChI | InChI=1S/C6H8N2OS.C2H6/c1-4-5(2)10-6(8-4)7-3-9;1-2/h3H,1-2H3,(H,7,8,9);1-2H3 |
| InChIKey | GDIPVOPWPLTCIR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane?
The IUPAC name of N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane (CID 142027710) is N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane.
What is the SMILES notation for N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane?
The canonical SMILES for N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane is CC.Cc1nc(NC=O)sc1C.
What is the InChIKey of N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane?
The InChIKey is GDIPVOPWPLTCIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS.C2H6/c1-4-5(2)10-6(8-4)7-3-9;1-2/h3H,1-2H3,(H,7,8,9);1-2H3.
What are the key properties of N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane?
N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane has a molecular weight of 186.28 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dimethyl-1,3-thiazol-2-yl)formamide;ethane is sourced from PubChem (CID 142027710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).