C8H10N2O4S — CID 130595687
2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanedioic acid (PubChem CID 130595687) has the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanedioic acid.
| Compound Name | 2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanedioic acid |
|---|---|
| PubChem CID | 130595687 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanedioic acid |
| SMILES | Cc1nc(NC(C(=O)O)C(=O)O)sc1C |
| InChI | InChI=1S/C8H10N2O4S/c1-3-4(2)15-8(9-3)10-5(6(11)12)7(13)14/h5H,1-2H3,(H,9,10)(H,11,12)(H,13,14) |
| InChIKey | FMEUAQFWSHYMAF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|