C8H11N3O3S2 — CID 44546243
(2R)-2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid (PubChem CID 44546243) has the molecular formula C8H11N3O3S2 and a molecular weight of 261.33 g/mol. Its IUPAC name is (2R)-2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid.
| Compound Name | (2R)-2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid |
|---|---|
| PubChem CID | 44546243 |
| Molecular Formula | C8H11N3O3S2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | (2R)-2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid |
| SMILES | Cc1nc(N[C@@H](CSN=O)C(=O)O)sc1C |
| InChI | InChI=1S/C8H11N3O3S2/c1-4-5(2)16-8(9-4)10-6(7(12)13)3-15-11-14/h6H,3H2,1-2H3,(H,9,10)(H,12,13)/t6-/m0/s1 |
| InChIKey | BUGGKVCFWMBVKR-LURJTMIESA-N |
| XLogP | 2.04 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|