About 4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine
4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine (PubChem CID 115899342) has the molecular formula C10H18N2S2
and a molecular weight of 230.40 g/mol. Its IUPAC name is 4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine |
| PubChem CID | 115899342 |
| Molecular Formula | C10H18N2S2 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine |
| SMILES | CCC(CSC)Nc1nc(C)c(C)s1 |
| InChI | InChI=1S/C10H18N2S2/c1-5-9(6-13-4)12-10-11-7(2)8(3)14-10/h9H,5-6H2,1-4H3,(H,11,12) |
| InChIKey | AMBUQYAYRJMDPE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine?
The IUPAC name of 4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine (CID 115899342) is 4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine?
The canonical SMILES for 4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine is CCC(CSC)Nc1nc(C)c(C)s1.
What is the InChIKey of 4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine?
The InChIKey is AMBUQYAYRJMDPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S2/c1-5-9(6-13-4)12-10-11-7(2)8(3)14-10/h9H,5-6H2,1-4H3,(H,11,12).
What are the key properties of 4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine?
4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine has a molecular weight of 230.40 g/mol, XLogP of 3.31, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-N-(1-methylsulfanylbutan-2-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 115899342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).