C5H6ClN3OS — CID 130775691
(4-chloro-3-methyl-1,2-thiazol-5-yl)urea (PubChem CID 130775691) has the molecular formula C5H6ClN3OS and a molecular weight of 191.64 g/mol. Its IUPAC name is (4-chloro-3-methyl-1,2-thiazol-5-yl)urea.
| Compound Name | (4-chloro-3-methyl-1,2-thiazol-5-yl)urea |
|---|---|
| PubChem CID | 130775691 |
| Molecular Formula | C5H6ClN3OS |
| Molecular Weight | 191.64 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | (4-chloro-3-methyl-1,2-thiazol-5-yl)urea |
| SMILES | Cc1nsc(NC(N)=O)c1Cl |
| InChI | InChI=1S/C5H6ClN3OS/c1-2-3(6)4(11-9-2)8-5(7)10/h1H3,(H3,7,8,10) |
| InChIKey | RUBAGHPOSXUXJE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.64 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |