C10H16N4O2S — CID 134119367
5-(carbamoylamino)-3-pentyl-1,2-thiazole-4-carboxamide (PubChem CID 134119367) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 5-(carbamoylamino)-3-pentyl-1,2-thiazole-4-carboxamide.
| Compound Name | 5-(carbamoylamino)-3-pentyl-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 134119367 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 5-(carbamoylamino)-3-pentyl-1,2-thiazole-4-carboxamide |
| SMILES | CCCCCc1nsc(NC(N)=O)c1C(N)=O |
| InChI | InChI=1S/C10H16N4O2S/c1-2-3-4-5-6-7(8(11)15)9(17-14-6)13-10(12)16/h2-5H2,1H3,(H2,11,15)(H3,12,13,16) |
| InChIKey | LEFNHGCEXMHGMZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|