C9H13N3O2S — CID 134103425
3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide (PubChem CID 134103425) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 134103425 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide |
| SMILES | CCC(=O)Nc1snc(CC)c1C(N)=O |
| InChI | InChI=1S/C9H13N3O2S/c1-3-5-7(8(10)14)9(15-12-5)11-6(13)4-2/h3-4H2,1-2H3,(H2,10,14)(H,11,13) |
| InChIKey | BTGBXGSFIOJBEY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |