About 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide
3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide (PubChem CID 134103425) has the molecular formula C9H13N3O2S
and a molecular weight of 227.29 g/mol. Its IUPAC name is 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide |
| PubChem CID | 134103425 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide |
| SMILES | CCC(=O)Nc1snc(CC)c1C(N)=O |
| InChI | InChI=1S/C9H13N3O2S/c1-3-5-7(8(10)14)9(15-12-5)11-6(13)4-2/h3-4H2,1-2H3,(H2,10,14)(H,11,13) |
| InChIKey | BTGBXGSFIOJBEY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide?
The IUPAC name of 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide (CID 134103425) is 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide.
What is the SMILES notation for 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide?
The canonical SMILES for 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide is CCC(=O)Nc1snc(CC)c1C(N)=O.
What is the InChIKey of 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide?
The InChIKey is BTGBXGSFIOJBEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2S/c1-3-5-7(8(10)14)9(15-12-5)11-6(13)4-2/h3-4H2,1-2H3,(H2,10,14)(H,11,13).
What are the key properties of 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide?
3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide has a molecular weight of 227.29 g/mol, XLogP of 1.15, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-(propanoylamino)-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 134103425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).