C18H16ClN3O2S — CID 70273771
2-[3-(4-aminophenoxy)phenyl]-N-(4-chloro-3-methyl-1,2-thiazol-5-yl)acetamide (PubChem CID 70273771) has the molecular formula C18H16ClN3O2S and a molecular weight of 373.87 g/mol. Its IUPAC name is 2-[3-(4-aminophenoxy)phenyl]-N-(4-chloro-3-methyl-1,2-thiazol-5-yl)acetamide.
| Compound Name | 2-[3-(4-aminophenoxy)phenyl]-N-(4-chloro-3-methyl-1,2-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 70273771 |
| Molecular Formula | C18H16ClN3O2S |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-[3-(4-aminophenoxy)phenyl]-N-(4-chloro-3-methyl-1,2-thiazol-5-yl)acetamide |
| SMILES | Cc1nsc(NC(=O)Cc2cccc(Oc3ccc(N)cc3)c2)c1Cl |
| InChI | InChI=1S/C18H16ClN3O2S/c1-11-17(19)18(25-22-11)21-16(23)10-12-3-2-4-15(9-12)24-14-7-5-13(20)6-8-14/h2-9H,10,20H2,1H3,(H,21,23) |
| InChIKey | UMYGIUKMJODSEL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|