C12H10N4OS — CID 79375777
4-[(4-cyano-3-methyl-1,2-thiazol-5-yl)amino]benzamide (PubChem CID 79375777) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is 4-[(4-cyano-3-methyl-1,2-thiazol-5-yl)amino]benzamide.
| Compound Name | 4-[(4-cyano-3-methyl-1,2-thiazol-5-yl)amino]benzamide |
|---|---|
| PubChem CID | 79375777 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 4-[(4-cyano-3-methyl-1,2-thiazol-5-yl)amino]benzamide |
| SMILES | Cc1nsc(Nc2ccc(C(N)=O)cc2)c1C#N |
| InChI | InChI=1S/C12H10N4OS/c1-7-10(6-13)12(18-16-7)15-9-4-2-8(3-5-9)11(14)17/h2-5,15H,1H3,(H2,14,17) |
| InChIKey | CRGGXTKKOCFQGP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |