C18H13N3OS2 — CID 134103620
5-anilino-3-phenacylsulfanyl-1,2-thiazole-4-carbonitrile (PubChem CID 134103620) has the molecular formula C18H13N3OS2 and a molecular weight of 351.46 g/mol. Its IUPAC name is 5-anilino-3-phenacylsulfanyl-1,2-thiazole-4-carbonitrile.
| Compound Name | 5-anilino-3-phenacylsulfanyl-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 134103620 |
| Molecular Formula | C18H13N3OS2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 5-anilino-3-phenacylsulfanyl-1,2-thiazole-4-carbonitrile |
| SMILES | N#Cc1c(SCC(=O)c2ccccc2)nsc1Nc1ccccc1 |
| InChI | InChI=1S/C18H13N3OS2/c19-11-15-17(20-14-9-5-2-6-10-14)24-21-18(15)23-12-16(22)13-7-3-1-4-8-13/h1-10,20H,12H2 |
| InChIKey | DUZRCXIDMIFDIA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |