C17H15N4OS+ — CID 6942584
2-amino-4-ethyl-6-phenacylsulfanylpyridin-1-ium-3,5-dicarbonitrile (PubChem CID 6942584) has the molecular formula C17H15N4OS+ and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-amino-4-ethyl-6-phenacylsulfanylpyridin-1-ium-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-ethyl-6-phenacylsulfanylpyridin-1-ium-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 6942584 |
| Molecular Formula | C17H15N4OS+ |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-amino-4-ethyl-6-phenacylsulfanylpyridin-1-ium-3,5-dicarbonitrile |
| SMILES | CCc1c(C#N)c(N)[nH+]c(SCC(=O)c2ccccc2)c1C#N |
| InChI | InChI=1S/C17H14N4OS/c1-2-12-13(8-18)16(20)21-17(14(12)9-19)23-10-15(22)11-6-4-3-5-7-11/h3-7H,2,10H2,1H3,(H2,20,21)/p+1 |
| InChIKey | LNWWAWFKMDMSKA-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |