C12H13F2NO2 — CID 115527096
2-[3-(difluoromethyl)phenyl]-2-(prop-2-enylamino)acetic acid (PubChem CID 115527096) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)phenyl]-2-(prop-2-enylamino)acetic acid.
| Compound Name | 2-[3-(difluoromethyl)phenyl]-2-(prop-2-enylamino)acetic acid |
|---|---|
| PubChem CID | 115527096 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-[3-(difluoromethyl)phenyl]-2-(prop-2-enylamino)acetic acid |
| SMILES | C=CCNC(C(=O)O)c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C12H13F2NO2/c1-2-6-15-10(12(16)17)8-4-3-5-9(7-8)11(13)14/h2-5,7,10-11,15H,1,6H2,(H,16,17) |
| InChIKey | XQCJGVDISHJEDZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|