C24H34O6 — CID 11553515
(3E,5E,7E,14E,16E,18E)-10,12,20-trihydroxy-22-(2-hydroxypropyl)-1-oxacyclodocosa-3,5,7,14,16,18-hexaen-2-one (PubChem CID 11553515) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is (3E,5E,7E,14E,16E,18E)-10,12,20-trihydroxy-22-(2-hydroxypropyl)-1-oxacyclodocosa-3,5,7,14,16,18-hexaen-2-one.
| Compound Name | (3E,5E,7E,14E,16E,18E)-10,12,20-trihydroxy-22-(2-hydroxypropyl)-1-oxacyclodocosa-3,5,7,14,16,18-hexaen-2-one |
|---|---|
| PubChem CID | 11553515 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (3E,5E,7E,14E,16E,18E)-10,12,20-trihydroxy-22-(2-hydroxypropyl)-1-oxacyclodocosa-3,5,7,14,16,18-hexaen-2-one |
| SMILES | CC(O)CC1CC(O)/C=C/C=C/C=C/CC(O)CC(O)C/C=C/C=C/C=C/C(=O)O1 |
| InChI | InChI=1S/C24H34O6/c1-19(25)16-23-18-22(28)14-10-5-2-4-8-12-20(26)17-21(27)13-9-6-3-7-11-15-24(29)30-23/h2-11,14-15,19-23,25-28H,12-13,16-18H2,1H3/b5-2+,7-3+,8-4+,9-6+,14-10+,15-11+ |
| InChIKey | SEDBAVXIUFCBOQ-TVAXXASCSA-N |
| XLogP | 2.66 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |