C24H24N4O3S — CID 11554168
2-[[3-ethyl-1-(2-methylphenyl)-4-(4-methyl-1,3-thiazol-2-yl)pyrazol-5-yl]amino]-5-methoxybenzoic acid (PubChem CID 11554168) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-[[3-ethyl-1-(2-methylphenyl)-4-(4-methyl-1,3-thiazol-2-yl)pyrazol-5-yl]amino]-5-methoxybenzoic acid.
| Compound Name | 2-[[3-ethyl-1-(2-methylphenyl)-4-(4-methyl-1,3-thiazol-2-yl)pyrazol-5-yl]amino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 11554168 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 2-[[3-ethyl-1-(2-methylphenyl)-4-(4-methyl-1,3-thiazol-2-yl)pyrazol-5-yl]amino]-5-methoxybenzoic acid |
| SMILES | CCc1nn(-c2ccccc2C)c(Nc2ccc(OC)cc2C(=O)O)c1-c1nc(C)cs1 |
| InChI | InChI=1S/C24H24N4O3S/c1-5-18-21(23-25-15(3)13-32-23)22(28(27-18)20-9-7-6-8-14(20)2)26-19-11-10-16(31-4)12-17(19)24(29)30/h6-13,26H,5H2,1-4H3,(H,29,30) |
| InChIKey | WWWSQZRCZZHQER-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_acid_G(1)', 'substructure': 'N/A'} |
|---|