C26H23N5O3 — CID 46175998
2-[[4-(1H-indazol-5-yl)-3-methyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-5-methoxybenzoic acid (PubChem CID 46175998) has the molecular formula C26H23N5O3 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2-[[4-(1H-indazol-5-yl)-3-methyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-5-methoxybenzoic acid.
| Compound Name | 2-[[4-(1H-indazol-5-yl)-3-methyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 46175998 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-[[4-(1H-indazol-5-yl)-3-methyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-5-methoxybenzoic acid |
| SMILES | COc1ccc(Nc2c(-c3ccc4[nH]ncc4c3)c(C)nn2-c2ccccc2C)c(C(=O)O)c1 |
| InChI | InChI=1S/C26H23N5O3/c1-15-6-4-5-7-23(15)31-25(28-22-11-9-19(34-3)13-20(22)26(32)33)24(16(2)30-31)17-8-10-21-18(12-17)14-27-29-21/h4-14,28H,1-3H3,(H,27,29)(H,32,33) |
| InChIKey | YPKKYRGZMHMKSN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_acid_G(1)', 'substructure': 'N/A'} |
|---|