C24H21N3O3 — CID 69276977
5-methoxy-2-[(3-methyl-1,4-diphenylpyrazol-5-yl)amino]benzoic acid (PubChem CID 69276977) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 5-methoxy-2-[(3-methyl-1,4-diphenylpyrazol-5-yl)amino]benzoic acid.
| Compound Name | 5-methoxy-2-[(3-methyl-1,4-diphenylpyrazol-5-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 69276977 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 5-methoxy-2-[(3-methyl-1,4-diphenylpyrazol-5-yl)amino]benzoic acid |
| SMILES | COc1ccc(Nc2c(-c3ccccc3)c(C)nn2-c2ccccc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C24H21N3O3/c1-16-22(17-9-5-3-6-10-17)23(27(26-16)18-11-7-4-8-12-18)25-21-14-13-19(30-2)15-20(21)24(28)29/h3-15,25H,1-2H3,(H,28,29) |
| InChIKey | XJQGUYCIQKKDKB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_G(1)', 'substructure': 'N/A'} |
|---|