C24H20N4O3S — CID 69309471
2-[[4-(4-cyanothiophen-3-yl)-3-methyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-5-methoxybenzoic acid (PubChem CID 69309471) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is 2-[[4-(4-cyanothiophen-3-yl)-3-methyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-5-methoxybenzoic acid.
| Compound Name | 2-[[4-(4-cyanothiophen-3-yl)-3-methyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 69309471 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 2-[[4-(4-cyanothiophen-3-yl)-3-methyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-5-methoxybenzoic acid |
| SMILES | COc1ccc(Nc2c(-c3cscc3C#N)c(C)nn2-c2ccccc2C)c(C(=O)O)c1 |
| InChI | InChI=1S/C24H20N4O3S/c1-14-6-4-5-7-21(14)28-23(22(15(2)27-28)19-13-32-12-16(19)11-25)26-20-9-8-17(31-3)10-18(20)24(29)30/h4-10,12-13,26H,1-3H3,(H,29,30) |
| InChIKey | CYBYYSVFLYRRFP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_acid_G(1)', 'substructure': 'N/A'} |
|---|