C25H23N3O3 — CID 69277760
5-methoxy-2-[[1-(2-methylphenyl)-3-(4-methylphenyl)pyrazol-5-yl]amino]benzoic acid (PubChem CID 69277760) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 5-methoxy-2-[[1-(2-methylphenyl)-3-(4-methylphenyl)pyrazol-5-yl]amino]benzoic acid.
| Compound Name | 5-methoxy-2-[[1-(2-methylphenyl)-3-(4-methylphenyl)pyrazol-5-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 69277760 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 5-methoxy-2-[[1-(2-methylphenyl)-3-(4-methylphenyl)pyrazol-5-yl]amino]benzoic acid |
| SMILES | COc1ccc(Nc2cc(-c3ccc(C)cc3)nn2-c2ccccc2C)c(C(=O)O)c1 |
| InChI | InChI=1S/C25H23N3O3/c1-16-8-10-18(11-9-16)22-15-24(28(27-22)23-7-5-4-6-17(23)2)26-21-13-12-19(31-3)14-20(21)25(29)30/h4-15,26H,1-3H3,(H,29,30) |
| InChIKey | VBVUIYCTEVUWDS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_G(1)', 'substructure': 'N/A'} |
|---|