C25H22FN3O2 — CID 69278426
5-ethyl-2-[[3-(4-fluorophenyl)-1-(2-methylphenyl)pyrazol-5-yl]amino]benzoic acid (PubChem CID 69278426) has the molecular formula C25H22FN3O2 and a molecular weight of 415.47 g/mol. Its IUPAC name is 5-ethyl-2-[[3-(4-fluorophenyl)-1-(2-methylphenyl)pyrazol-5-yl]amino]benzoic acid.
| Compound Name | 5-ethyl-2-[[3-(4-fluorophenyl)-1-(2-methylphenyl)pyrazol-5-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 69278426 |
| Molecular Formula | C25H22FN3O2 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 5-ethyl-2-[[3-(4-fluorophenyl)-1-(2-methylphenyl)pyrazol-5-yl]amino]benzoic acid |
| SMILES | CCc1ccc(Nc2cc(-c3ccc(F)cc3)nn2-c2ccccc2C)c(C(=O)O)c1 |
| InChI | InChI=1S/C25H22FN3O2/c1-3-17-8-13-21(20(14-17)25(30)31)27-24-15-22(18-9-11-19(26)12-10-18)28-29(24)23-7-5-4-6-16(23)2/h4-15,27H,3H2,1-2H3,(H,30,31) |
| InChIKey | BHRBBKSXBAXKGK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |