C25H24N4O2 — CID 69136105
methyl 2-[[3-(3-ethylphenyl)-1-(4-methyl-3-pyridinyl)pyrazol-5-yl]amino]benzoate (PubChem CID 69136105) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is methyl 2-[[3-(3-ethylphenyl)-1-(4-methyl-3-pyridinyl)pyrazol-5-yl]amino]benzoate.
| Compound Name | methyl 2-[[3-(3-ethylphenyl)-1-(4-methyl-3-pyridinyl)pyrazol-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 69136105 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | methyl 2-[[3-(3-ethylphenyl)-1-(4-methyl-3-pyridinyl)pyrazol-5-yl]amino]benzoate |
| SMILES | CCc1cccc(-c2cc(Nc3ccccc3C(=O)OC)n(-c3cnccc3C)n2)c1 |
| InChI | InChI=1S/C25H24N4O2/c1-4-18-8-7-9-19(14-18)22-15-24(29(28-22)23-16-26-13-12-17(23)2)27-21-11-6-5-10-20(21)25(30)31-3/h5-16,27H,4H2,1-3H3 |
| InChIKey | DQWJWIPOPLNCFZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |