C23H20N4O3 — CID 71211731
5-methoxy-2-[[3-(4-methylphenyl)-1-pyridin-2-ylpyrazol-5-yl]amino]benzoic acid (PubChem CID 71211731) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 5-methoxy-2-[[3-(4-methylphenyl)-1-pyridin-2-ylpyrazol-5-yl]amino]benzoic acid.
| Compound Name | 5-methoxy-2-[[3-(4-methylphenyl)-1-pyridin-2-ylpyrazol-5-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 71211731 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 5-methoxy-2-[[3-(4-methylphenyl)-1-pyridin-2-ylpyrazol-5-yl]amino]benzoic acid |
| SMILES | COc1ccc(Nc2cc(-c3ccc(C)cc3)nn2-c2ccccn2)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H20N4O3/c1-15-6-8-16(9-7-15)20-14-22(27(26-20)21-5-3-4-12-24-21)25-19-11-10-17(30-2)13-18(19)23(28)29/h3-14,25H,1-2H3,(H,28,29) |
| InChIKey | HYVJGQFSZYFVLS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_acid_G(1)', 'substructure': 'N/A'} |
|---|