C16H23N3S — CID 115551794
4-methyl-3-(1-propylpiperidin-4-yl)-1H-benzimidazole-2-thione (PubChem CID 115551794) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 4-methyl-3-(1-propylpiperidin-4-yl)-1H-benzimidazole-2-thione.
| Compound Name | 4-methyl-3-(1-propylpiperidin-4-yl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115551794 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 4-methyl-3-(1-propylpiperidin-4-yl)-1H-benzimidazole-2-thione |
| SMILES | CCCN1CCC(n2c(=S)[nH]c3cccc(C)c32)CC1 |
| InChI | InChI=1S/C16H23N3S/c1-3-9-18-10-7-13(8-11-18)19-15-12(2)5-4-6-14(15)17-16(19)20/h4-6,13H,3,7-11H2,1-2H3,(H,17,20) |
| InChIKey | UXOPYOPTBVNNKY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|