C15H19N3S — CID 115551826
3-(1-cyclopropylpyrrolidin-3-yl)-4-methyl-1H-benzimidazole-2-thione (PubChem CID 115551826) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 3-(1-cyclopropylpyrrolidin-3-yl)-4-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-(1-cyclopropylpyrrolidin-3-yl)-4-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115551826 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 3-(1-cyclopropylpyrrolidin-3-yl)-4-methyl-1H-benzimidazole-2-thione |
| SMILES | Cc1cccc2[nH]c(=S)n(C3CCN(C4CC4)C3)c12 |
| InChI | InChI=1S/C15H19N3S/c1-10-3-2-4-13-14(10)18(15(19)16-13)12-7-8-17(9-12)11-5-6-11/h2-4,11-12H,5-9H2,1H3,(H,16,19) |
| InChIKey | WGRDCJMBBHCVOY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|