C15H15F3N2O — CID 115556866
1-(cyclopropylmethyl)-1-prop-2-ynyl-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 115556866) has the molecular formula C15H15F3N2O and a molecular weight of 296.29 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-1-prop-2-ynyl-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(cyclopropylmethyl)-1-prop-2-ynyl-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 115556866 |
| Molecular Formula | C15H15F3N2O |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-(cyclopropylmethyl)-1-prop-2-ynyl-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | C#CCN(CC1CC1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H15F3N2O/c1-2-9-20(10-11-3-4-11)14(21)19-13-7-5-12(6-8-13)15(16,17)18/h1,5-8,11H,3-4,9-10H2,(H,19,21) |
| InChIKey | UQXLFDSZSSQCCF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|