C17H20N2OS — CID 115562471
[2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-phenyl-1,3-thiazol-5-yl]methanol (PubChem CID 115562471) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is [2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-phenyl-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-phenyl-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 115562471 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | [2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-phenyl-1,3-thiazol-5-yl]methanol |
| SMILES | OCc1sc(N2CC3CCCC3C2)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H20N2OS/c20-11-15-16(12-5-2-1-3-6-12)18-17(21-15)19-9-13-7-4-8-14(13)10-19/h1-3,5-6,13-14,20H,4,7-11H2 |
| InChIKey | YMDAXCDJNCAXHF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |