C10H4F5N3O2S — CID 115564672
2-[[4-(2,3,4,5,6-pentafluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 115564672) has the molecular formula C10H4F5N3O2S and a molecular weight of 325.22 g/mol. Its IUPAC name is 2-[[4-(2,3,4,5,6-pentafluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[4-(2,3,4,5,6-pentafluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 115564672 |
| Molecular Formula | C10H4F5N3O2S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2-[[4-(2,3,4,5,6-pentafluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nncn1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H4F5N3O2S/c11-4-5(12)7(14)9(8(15)6(4)13)18-2-16-17-10(18)21-1-3(19)20/h2H,1H2,(H,19,20) |
| InChIKey | PXLTWFQFIDNHNP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|